About [4-(bromomethyl)phenyl]boronic acid;oxolane
[4-(bromomethyl)phenyl]boronic acid;oxolane (PubChem CID 157137477) has the molecular formula C11H16BBrO3
and a molecular weight of 286.96 g/mol. Its IUPAC name is [4-(bromomethyl)phenyl]boronic acid;oxolane.
Molecular Properties
| Compound Name | [4-(bromomethyl)phenyl]boronic acid;oxolane |
| PubChem CID | 157137477 |
| Molecular Formula | C11H16BBrO3 |
| Molecular Weight | 286.96 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | [4-(bromomethyl)phenyl]boronic acid;oxolane |
| SMILES | C1CCOC1.OB(O)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C7H8BBrO2.C4H8O/c9-5-6-1-3-7(4-2-6)8(10)11;1-2-4-5-3-1/h1-4,10-11H,5H2;1-4H2 |
| InChIKey | AJUFOAWGOQZDRF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.96 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-(bromomethyl)phenyl]boronic acid;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(bromomethyl)phenyl]boronic acid;oxolane?
The IUPAC name of [4-(bromomethyl)phenyl]boronic acid;oxolane (CID 157137477) is [4-(bromomethyl)phenyl]boronic acid;oxolane.
What is the SMILES notation for [4-(bromomethyl)phenyl]boronic acid;oxolane?
The canonical SMILES for [4-(bromomethyl)phenyl]boronic acid;oxolane is C1CCOC1.OB(O)c1ccc(CBr)cc1.
What is the InChIKey of [4-(bromomethyl)phenyl]boronic acid;oxolane?
The InChIKey is AJUFOAWGOQZDRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BBrO2.C4H8O/c9-5-6-1-3-7(4-2-6)8(10)11;1-2-4-5-3-1/h1-4,10-11H,5H2;1-4H2.
What are the key properties of [4-(bromomethyl)phenyl]boronic acid;oxolane?
[4-(bromomethyl)phenyl]boronic acid;oxolane has a molecular weight of 286.96 g/mol, XLogP of 1.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(bromomethyl)phenyl]boronic acid;oxolane is sourced from PubChem (CID 157137477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).