C34H75NO — CID 157137544
1-(3,3-dimethylbutoxy)-3,3-dimethylbutane;N-(3,3-dimethylbutyl)-N,3,3-trimethylbutan-1-amine;2,2,4,4-tetramethylpentane (PubChem CID 157137544) has the molecular formula C34H75NO and a molecular weight of 513.98 g/mol. Its IUPAC name is 1-(3,3-dimethylbutoxy)-3,3-dimethylbutane;N-(3,3-dimethylbutyl)-N,3,3-trimethylbutan-1-amine;2,2,4,4-tetramethylpentane.
| Compound Name | 1-(3,3-dimethylbutoxy)-3,3-dimethylbutane;N-(3,3-dimethylbutyl)-N,3,3-trimethylbutan-1-amine;2,2,4,4-tetramethylpentane |
|---|---|
| PubChem CID | 157137544 |
| Molecular Formula | C34H75NO |
| Molecular Weight | 513.98 g/mol |
| Exact Mass | 513.58 |
| IUPAC Name | 1-(3,3-dimethylbutoxy)-3,3-dimethylbutane;N-(3,3-dimethylbutyl)-N,3,3-trimethylbutan-1-amine;2,2,4,4-tetramethylpentane |
| SMILES | CC(C)(C)CC(C)(C)C.CC(C)(C)CCOCCC(C)(C)C.CN(CCC(C)(C)C)CCC(C)(C)C |
| InChI | InChI=1S/C13H29N.C12H26O.C9H20/c1-12(2,3)8-10-14(7)11-9-13(4,5)6;1-11(2,3)7-9-13-10-8-12(4,5)6;1-8(2,3)7-9(4,5)6/h8-11H2,1-7H3;7-10H2,1-6H3;7H2,1-6H3 |
| InChIKey | AJUJVSUAMUVBQY-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.98 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|