C17H9BrF6N2O — CID 157137869
2-[[2,4-bis(trifluoromethyl)phenyl]methyl]-3-bromoindazole-6-carbaldehyde (PubChem CID 157137869) has the molecular formula C17H9BrF6N2O and a molecular weight of 451.16 g/mol. Its IUPAC name is 2-[[2,4-bis(trifluoromethyl)phenyl]methyl]-3-bromoindazole-6-carbaldehyde.
| Compound Name | 2-[[2,4-bis(trifluoromethyl)phenyl]methyl]-3-bromoindazole-6-carbaldehyde |
|---|---|
| PubChem CID | 157137869 |
| Molecular Formula | C17H9BrF6N2O |
| Molecular Weight | 451.16 g/mol |
| Exact Mass | 449.98 |
| IUPAC Name | 2-[[2,4-bis(trifluoromethyl)phenyl]methyl]-3-bromoindazole-6-carbaldehyde |
| SMILES | O=Cc1ccc2c(Br)n(Cc3ccc(C(F)(F)F)cc3C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C17H9BrF6N2O/c18-15-12-4-1-9(8-27)5-14(12)25-26(15)7-10-2-3-11(16(19,20)21)6-13(10)17(22,23)24/h1-6,8H,7H2 |
| InChIKey | MJWCXWXDWAKGTC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.16 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|