C33H57N5O4S4 — CID 157137903
N-ethyl-3-[[3-(ethylamino)-3-oxopropyl]disulfanyl]propanamide;N-ethyl-8-oxoundecanamide;2-methyl-4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1,3-thiazole (PubChem CID 157137903) has the molecular formula C33H57N5O4S4 and a molecular weight of 716.12 g/mol. Its IUPAC name is N-ethyl-3-[[3-(ethylamino)-3-oxopropyl]disulfanyl]propanamide;N-ethyl-8-oxoundecanamide;2-methyl-4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1,3-thiazole.
| Compound Name | N-ethyl-3-[[3-(ethylamino)-3-oxopropyl]disulfanyl]propanamide;N-ethyl-8-oxoundecanamide;2-methyl-4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 157137903 |
| Molecular Formula | C33H57N5O4S4 |
| Molecular Weight | 716.12 g/mol |
| Exact Mass | 715.33 |
| IUPAC Name | N-ethyl-3-[[3-(ethylamino)-3-oxopropyl]disulfanyl]propanamide;N-ethyl-8-oxoundecanamide;2-methyl-4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1,3-thiazole |
| SMILES | CCCC(=O)CCCCCCC(=O)NCC.CCNC(=O)CCSSCCC(=O)NCC.Cc1nc(CCc2csc(C)n2)cs1 |
| InChI | InChI=1S/C13H25NO2.C10H20N2O2S2.C10H12N2S2/c1-3-9-12(15)10-7-5-6-8-11-13(16)14-4-2;1-3-11-9(13)5-7-15-16-8-6-10(14)12-4-2;1-7-11-9(5-13-7)3-4-10-6-14-8(2)12-10/h3-11H2,1-2H3,(H,14,16);3-8H2,1-2H3,(H,11,13)(H,12,14);5-6H,3-4H2,1-2H3 |
| InChIKey | AJVPEGQAHIPSMS-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 130.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.12 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|