About 2,3-dihydroisoindol-1-one;perylene
2,3-dihydroisoindol-1-one;perylene (PubChem CID 157138971) has the molecular formula C28H19NO
and a molecular weight of 385.47 g/mol. Its IUPAC name is 2,3-dihydroisoindol-1-one;perylene.
Molecular Properties
| Compound Name | 2,3-dihydroisoindol-1-one;perylene |
| PubChem CID | 157138971 |
| Molecular Formula | C28H19NO |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 2,3-dihydroisoindol-1-one;perylene |
| SMILES | O=C1NCc2ccccc21.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12.C8H7NO/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;10-8-7-4-2-1-3-6(7)5-9-8/h1-12H;1-4H,5H2,(H,9,10) |
| InChIKey | AJYUDXHOPIULAQ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroisoindol-1-one;perylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroisoindol-1-one;perylene?
The IUPAC name of 2,3-dihydroisoindol-1-one;perylene (CID 157138971) is 2,3-dihydroisoindol-1-one;perylene.
What is the SMILES notation for 2,3-dihydroisoindol-1-one;perylene?
The canonical SMILES for 2,3-dihydroisoindol-1-one;perylene is O=C1NCc2ccccc21.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54.
What is the InChIKey of 2,3-dihydroisoindol-1-one;perylene?
The InChIKey is AJYUDXHOPIULAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12.C8H7NO/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;10-8-7-4-2-1-3-6(7)5-9-8/h1-12H;1-4H,5H2,(H,9,10).
What are the key properties of 2,3-dihydroisoindol-1-one;perylene?
2,3-dihydroisoindol-1-one;perylene has a molecular weight of 385.47 g/mol, XLogP of 6.67, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroisoindol-1-one;perylene is sourced from PubChem (CID 157138971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).