C16H28O3 — CID 15713912
5-(3-hydroxyoct-1-enylidene)-1,4,4-trimethylcyclopentane-1,3-diol (PubChem CID 15713912) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is 5-(3-hydroxyoct-1-enylidene)-1,4,4-trimethylcyclopentane-1,3-diol.
| Compound Name | 5-(3-hydroxyoct-1-enylidene)-1,4,4-trimethylcyclopentane-1,3-diol |
|---|---|
| PubChem CID | 15713912 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 5-(3-hydroxyoct-1-enylidene)-1,4,4-trimethylcyclopentane-1,3-diol |
| SMILES | CCCCCC(O)C=C=C1C(C)(O)CC(O)C1(C)C |
| InChI | InChI=1S/C16H28O3/c1-5-6-7-8-12(17)9-10-13-15(2,3)14(18)11-16(13,4)19/h9,12,14,17-19H,5-8,11H2,1-4H3 |
| InChIKey | MWSVADSWNXUSNF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|