About 4-amino-3-bromophenol
4-amino-3-bromophenol (PubChem CID 15713940) has the molecular formula C6H6BrNO
and a molecular weight of 188.02 g/mol. Its IUPAC name is 4-amino-3-bromophenol.
Molecular Properties
| Compound Name | 4-amino-3-bromophenol |
| PubChem CID | 15713940 |
| Molecular Formula | C6H6BrNO |
| Molecular Weight | 188.02 g/mol |
| Exact Mass | 186.96 |
| IUPAC Name | 4-amino-3-bromophenol |
| SMILES | Nc1ccc(O)cc1Br |
| InChI | InChI=1S/C6H6BrNO/c7-5-3-4(9)1-2-6(5)8/h1-3,9H,8H2 |
| InChIKey | JIRZAMLWKLMYLD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.02 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-bromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-bromophenol?
The IUPAC name of 4-amino-3-bromophenol (CID 15713940) is 4-amino-3-bromophenol.
What is the SMILES notation for 4-amino-3-bromophenol?
The canonical SMILES for 4-amino-3-bromophenol is Nc1ccc(O)cc1Br.
What is the InChIKey of 4-amino-3-bromophenol?
The InChIKey is JIRZAMLWKLMYLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrNO/c7-5-3-4(9)1-2-6(5)8/h1-3,9H,8H2.
What are the key properties of 4-amino-3-bromophenol?
4-amino-3-bromophenol has a molecular weight of 188.02 g/mol, XLogP of 1.74, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-bromophenol is sourced from PubChem (CID 15713940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).