C19H19F3N2O2 — CID 157139936
1-[[4-[5-(hydroxymethyl)-6-(trifluoromethyl)-2-pyridinyl]phenyl]methyl]piperidin-2-one (PubChem CID 157139936) has the molecular formula C19H19F3N2O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is 1-[[4-[5-(hydroxymethyl)-6-(trifluoromethyl)-2-pyridinyl]phenyl]methyl]piperidin-2-one.
| Compound Name | 1-[[4-[5-(hydroxymethyl)-6-(trifluoromethyl)-2-pyridinyl]phenyl]methyl]piperidin-2-one |
|---|---|
| PubChem CID | 157139936 |
| Molecular Formula | C19H19F3N2O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-[[4-[5-(hydroxymethyl)-6-(trifluoromethyl)-2-pyridinyl]phenyl]methyl]piperidin-2-one |
| SMILES | O=C1CCCCN1Cc1ccc(-c2ccc(CO)c(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C19H19F3N2O2/c20-19(21,22)18-15(12-25)8-9-16(23-18)14-6-4-13(5-7-14)11-24-10-2-1-3-17(24)26/h4-9,25H,1-3,10-12H2 |
| InChIKey | CEDVBKJPQWZNNF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |