C40H44B2Br2O4 — CID 157140352
2,7-dibromo-9,10-dihydrophenanthrene;4,4,5,5-tetramethyl-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-dihydrophenanthren-2-yl]-1,3,2-dioxaborolane (PubChem CID 157140352) has the molecular formula C40H44B2Br2O4 and a molecular weight of 770.22 g/mol. Its IUPAC name is 2,7-dibromo-9,10-dihydrophenanthrene;4,4,5,5-tetramethyl-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-dihydrophenanthren-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 2,7-dibromo-9,10-dihydrophenanthrene;4,4,5,5-tetramethyl-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-dihydrophenanthren-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 157140352 |
| Molecular Formula | C40H44B2Br2O4 |
| Molecular Weight | 770.22 g/mol |
| Exact Mass | 768.18 |
| IUPAC Name | 2,7-dibromo-9,10-dihydrophenanthrene;4,4,5,5-tetramethyl-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-dihydrophenanthren-2-yl]-1,3,2-dioxaborolane |
| SMILES | Brc1ccc2c(c1)CCc1cc(Br)ccc1-2.CC1(C)OB(c2ccc3c(c2)CCc2cc(B4OC(C)(C)C(C)(C)O4)ccc2-3)OC1(C)C |
| InChI | InChI=1S/C26H34B2O4.C14H10Br2/c1-23(2)24(3,4)30-27(29-23)19-11-13-21-17(15-19)9-10-18-16-20(12-14-22(18)21)28-31-25(5,6)26(7,8)32-28;15-11-3-5-13-9(7-11)1-2-10-8-12(16)4-6-14(10)13/h11-16H,9-10H2,1-8H3;3-8H,1-2H2 |
| InChIKey | AKCSXGRUJFTCQL-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.22 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|