C38H20Cl4F6N6O10S2 — CID 157140953
4-chloro-N-[5-chloro-2-(2-nitrobenzoyl)-3-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 157140953) has the molecular formula C38H20Cl4F6N6O10S2 and a molecular weight of 1040.54 g/mol. Its IUPAC name is 4-chloro-N-[5-chloro-2-(2-nitrobenzoyl)-3-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-[5-chloro-2-(2-nitrobenzoyl)-3-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 157140953 |
| Molecular Formula | C38H20Cl4F6N6O10S2 |
| Molecular Weight | 1040.54 g/mol |
| Exact Mass | 1037.93 |
| IUPAC Name | 4-chloro-N-[5-chloro-2-(2-nitrobenzoyl)-3-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=C(c1ccccc1[N+](=O)[O-])c1ncc(Cl)cc1NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1.O=C(c1ccccc1[N+](=O)[O-])c1ncc(Cl)cc1NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/2C19H10Cl2F3N3O5S/c2*20-10-7-15(17(25-9-10)18(28)12-3-1-2-4-16(12)27(29)30)26-33(31,32)11-5-6-14(21)13(8-11)19(22,23)24/h2*1-9,26H |
| InChIKey | AKEIDXKGKAJSJX-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 238.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1040.54 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|