C38H57N5O5 — CID 15714121
(2R)-4-(4-aminopiperidin-1-yl)-2-benzyl-N-[(2S)-1-[[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-pyridin-2-ylhexan-2-yl]amino]-1-oxopentan-2-yl]-4-oxobutanamide (PubChem CID 15714121) has the molecular formula C38H57N5O5 and a molecular weight of 663.90 g/mol. Its IUPAC name is (2R)-4-(4-aminopiperidin-1-yl)-2-benzyl-N-[(2S)-1-[[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-pyridin-2-ylhexan-2-yl]amino]-1-oxopentan-2-yl]-4-oxobutanamide.
| Compound Name | (2R)-4-(4-aminopiperidin-1-yl)-2-benzyl-N-[(2S)-1-[[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-pyridin-2-ylhexan-2-yl]amino]-1-oxopentan-2-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 15714121 |
| Molecular Formula | C38H57N5O5 |
| Molecular Weight | 663.90 g/mol |
| Exact Mass | 663.44 |
| IUPAC Name | (2R)-4-(4-aminopiperidin-1-yl)-2-benzyl-N-[(2S)-1-[[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-pyridin-2-ylhexan-2-yl]amino]-1-oxopentan-2-yl]-4-oxobutanamide |
| SMILES | CCC[C@H](NC(=O)[C@@H](CC(=O)N1CCC(N)CC1)Cc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)[C@@H](O)[C@@H](O)CCc1ccccn1 |
| InChI | InChI=1S/C38H57N5O5/c1-2-11-32(41-37(47)29(24-27-12-5-3-6-13-27)26-35(45)43-22-19-30(39)20-23-43)38(48)42-33(25-28-14-7-4-8-15-28)36(46)34(44)18-17-31-16-9-10-21-40-31/h3,5-6,9-10,12-13,16,21,28-30,32-34,36,44,46H,2,4,7-8,11,14-15,17-20,22-26,39H2,1H3,(H,41,47)(H,42,48)/t29-,32+,33+,34+,36-/m1/s1 |
| InChIKey | YHLOJFFKNNXDIO-DIIQFSBDSA-N |
| XLogP | 3.67 |
| TPSA | 157.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.90 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |