About (2S)-2-[4-(2-ethylphenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol
(2S)-2-[4-(2-ethylphenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 157142220) has the molecular formula C34H34F6O6S2
and a molecular weight of 716.76 g/mol. Its IUPAC name is (2S)-2-[4-(2-ethylphenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | (2S)-2-[4-(2-ethylphenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol |
| PubChem CID | 157142220 |
| Molecular Formula | C34H34F6O6S2 |
| Molecular Weight | 716.76 g/mol |
| Exact Mass | 716.17 |
| IUPAC Name | (2S)-2-[4-(2-ethylphenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CCc1ccccc1S(=O)(=O)c1ccc([C@](C)(O)C(F)(F)F)cc1.CCc1ccccc1S(=O)(=O)c1ccc([C@](C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/2C17H17F3O3S/c2*1-3-12-6-4-5-7-15(12)24(22,23)14-10-8-13(9-11-14)16(2,21)17(18,19)20/h2*4-11,21H,3H2,1-2H3/t2*16-/m00/s1 |
| InChIKey | AKHWMKXWDZYKTD-QSZVZPBDSA-N |
| XLogP | 7.70 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 716.76 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-2-[4-(2-ethylphenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[4-(2-ethylphenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol?
The IUPAC name of (2S)-2-[4-(2-ethylphenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol (CID 157142220) is (2S)-2-[4-(2-ethylphenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol.
What is the SMILES notation for (2S)-2-[4-(2-ethylphenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol?
The canonical SMILES for (2S)-2-[4-(2-ethylphenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol is CCc1ccccc1S(=O)(=O)c1ccc([C@](C)(O)C(F)(F)F)cc1.CCc1ccccc1S(=O)(=O)c1ccc([C@](C)(O)C(F)(F)F)cc1.
What is the InChIKey of (2S)-2-[4-(2-ethylphenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol?
The InChIKey is AKHWMKXWDZYKTD-QSZVZPBDSA-N. The full InChI is InChI=1S/2C17H17F3O3S/c2*1-3-12-6-4-5-7-15(12)24(22,23)14-10-8-13(9-11-14)16(2,21)17(18,19)20/h2*4-11,21H,3H2,1-2H3/t2*16-/m00/s1.
What are the key properties of (2S)-2-[4-(2-ethylphenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol?
(2S)-2-[4-(2-ethylphenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol has a molecular weight of 716.76 g/mol, XLogP of 7.70, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[4-(2-ethylphenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol is sourced from PubChem (CID 157142220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).