C34H39N5O2 — CID 157143157
2-amino-3,4-dimethylbenzoic acid;N-(7,8-dimethyl-2-naphthalen-2-ylquinazolin-4-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 157143157) has the molecular formula C34H39N5O2 and a molecular weight of 549.72 g/mol. Its IUPAC name is 2-amino-3,4-dimethylbenzoic acid;N-(7,8-dimethyl-2-naphthalen-2-ylquinazolin-4-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | 2-amino-3,4-dimethylbenzoic acid;N-(7,8-dimethyl-2-naphthalen-2-ylquinazolin-4-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 157143157 |
| Molecular Formula | C34H39N5O2 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | 2-amino-3,4-dimethylbenzoic acid;N-(7,8-dimethyl-2-naphthalen-2-ylquinazolin-4-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | Cc1ccc(C(=O)O)c(N)c1C.Cc1ccc2c(NCCCN(C)C)nc(-c3ccc4ccccc4c3)nc2c1C |
| InChI | InChI=1S/C25H28N4.C9H11NO2/c1-17-10-13-22-23(18(17)2)27-24(28-25(22)26-14-7-15-29(3)4)21-12-11-19-8-5-6-9-20(19)16-21;1-5-3-4-7(9(11)12)8(10)6(5)2/h5-6,8-13,16H,7,14-15H2,1-4H3,(H,26,27,28);3-4H,10H2,1-2H3,(H,11,12) |
| InChIKey | AKKIAGQRRPDACK-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|