C21H22O8S2 — CID 15714379
[(3S,4S,5R,6S)-4,5-diacetyloxy-6-(4-methyl-2-oxochromen-6-yl)sulfanylthian-3-yl] acetate (PubChem CID 15714379) has the molecular formula C21H22O8S2 and a molecular weight of 466.53 g/mol. Its IUPAC name is [(3S,4S,5R,6S)-4,5-diacetyloxy-6-(4-methyl-2-oxochromen-6-yl)sulfanylthian-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-(4-methyl-2-oxochromen-6-yl)sulfanylthian-3-yl] acetate |
|---|---|
| PubChem CID | 15714379 |
| Molecular Formula | C21H22O8S2 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-(4-methyl-2-oxochromen-6-yl)sulfanylthian-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](Sc2ccc3oc(=O)cc(C)c3c2)SC[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H22O8S2/c1-10-7-18(25)29-16-6-5-14(8-15(10)16)31-21-20(28-13(4)24)19(27-12(3)23)17(9-30-21)26-11(2)22/h5-8,17,19-21H,9H2,1-4H3/t17-,19+,20-,21+/m1/s1 |
| InChIKey | UFBBSYKYCURNIP-PMXSJFBMSA-N |
| XLogP | 3.06 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|