C21H19F3O8S2 — CID 15714381
[(3S,4S,5R,6S)-4,5-diacetyloxy-6-[2-oxo-4-(trifluoromethyl)chromen-7-yl]sulfanylthian-3-yl] acetate (PubChem CID 15714381) has the molecular formula C21H19F3O8S2 and a molecular weight of 520.50 g/mol. Its IUPAC name is [(3S,4S,5R,6S)-4,5-diacetyloxy-6-[2-oxo-4-(trifluoromethyl)chromen-7-yl]sulfanylthian-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-[2-oxo-4-(trifluoromethyl)chromen-7-yl]sulfanylthian-3-yl] acetate |
|---|---|
| PubChem CID | 15714381 |
| Molecular Formula | C21H19F3O8S2 |
| Molecular Weight | 520.50 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-[2-oxo-4-(trifluoromethyl)chromen-7-yl]sulfanylthian-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](Sc2ccc3c(C(F)(F)F)cc(=O)oc3c2)SC[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H19F3O8S2/c1-9(25)29-16-8-33-20(19(31-11(3)27)18(16)30-10(2)26)34-12-4-5-13-14(21(22,23)24)7-17(28)32-15(13)6-12/h4-7,16,18-20H,8H2,1-3H3/t16-,18+,19-,20+/m1/s1 |
| InChIKey | BGWUXHYGUDCNOO-MDNKFWRPSA-N |
| XLogP | 3.77 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|