C12H14ClN5O — CID 157144853
(4S)-4-amino-1-[5-chloro-2-(tetrazol-1-yl)phenyl]pentan-3-one (PubChem CID 157144853) has the molecular formula C12H14ClN5O and a molecular weight of 279.73 g/mol. Its IUPAC name is (4S)-4-amino-1-[5-chloro-2-(tetrazol-1-yl)phenyl]pentan-3-one.
| Compound Name | (4S)-4-amino-1-[5-chloro-2-(tetrazol-1-yl)phenyl]pentan-3-one |
|---|---|
| PubChem CID | 157144853 |
| Molecular Formula | C12H14ClN5O |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (4S)-4-amino-1-[5-chloro-2-(tetrazol-1-yl)phenyl]pentan-3-one |
| SMILES | C[C@H](N)C(=O)CCc1cc(Cl)ccc1-n1cnnn1 |
| InChI | InChI=1S/C12H14ClN5O/c1-8(14)12(19)5-2-9-6-10(13)3-4-11(9)18-7-15-16-17-18/h3-4,6-8H,2,5,14H2,1H3/t8-/m0/s1 |
| InChIKey | WIDZUFUTIZUMHJ-QMMMGPOBSA-N |
| XLogP | 1.16 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |