C3H10N2O2 — CID 157145452
1,1-dimethoxy-2-methylhydrazine (PubChem CID 157145452) has the molecular formula C3H10N2O2 and a molecular weight of 106.12 g/mol. Its IUPAC name is 1,1-dimethoxy-2-methylhydrazine.
| Compound Name | 1,1-dimethoxy-2-methylhydrazine |
|---|---|
| PubChem CID | 157145452 |
| Molecular Formula | C3H10N2O2 |
| Molecular Weight | 106.12 g/mol |
| Exact Mass | 106.07 |
| IUPAC Name | 1,1-dimethoxy-2-methylhydrazine |
| SMILES | CNN(OC)OC |
| InChI | InChI=1S/C3H10N2O2/c1-4-5(6-2)7-3/h4H,1-3H3 |
| InChIKey | PTWPTZLTQSYBDY-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 106.12 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|