C17H25ClO2 — CID 15714777
[(3E,6S,7S,9Z)-7-chloropentadeca-3,9-dien-1-yn-6-yl] acetate (PubChem CID 15714777) has the molecular formula C17H25ClO2 and a molecular weight of 296.84 g/mol. Its IUPAC name is [(3E,6S,7S,9Z)-7-chloropentadeca-3,9-dien-1-yn-6-yl] acetate.
| Compound Name | [(3E,6S,7S,9Z)-7-chloropentadeca-3,9-dien-1-yn-6-yl] acetate |
|---|---|
| PubChem CID | 15714777 |
| Molecular Formula | C17H25ClO2 |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | [(3E,6S,7S,9Z)-7-chloropentadeca-3,9-dien-1-yn-6-yl] acetate |
| SMILES | C#C/C=C/C[C@H](OC(C)=O)[C@@H](Cl)C/C=C\CCCCC |
| InChI | InChI=1S/C17H25ClO2/c1-4-6-8-9-10-12-13-16(18)17(20-15(3)19)14-11-7-5-2/h2,7,10-12,16-17H,4,6,8-9,13-14H2,1,3H3/b11-7+,12-10-/t16-,17-/m0/s1 |
| InChIKey | TZBIBCKLIXCLGL-PLAXZATRSA-N |
| XLogP | 4.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|