C37H74O11Si3 — CID 157148983
6-[diethoxy(ethyl)silyl]-2-methylhex-1-en-3-one;bis(6-[diethoxy(methoxy)silyl]-2-methylhex-1-en-3-one) (PubChem CID 157148983) has the molecular formula C37H74O11Si3 and a molecular weight of 779.25 g/mol. Its IUPAC name is 6-[diethoxy(ethyl)silyl]-2-methylhex-1-en-3-one;bis(6-[diethoxy(methoxy)silyl]-2-methylhex-1-en-3-one).
| Compound Name | 6-[diethoxy(ethyl)silyl]-2-methylhex-1-en-3-one;bis(6-[diethoxy(methoxy)silyl]-2-methylhex-1-en-3-one) |
|---|---|
| PubChem CID | 157148983 |
| Molecular Formula | C37H74O11Si3 |
| Molecular Weight | 779.25 g/mol |
| Exact Mass | 778.45 |
| IUPAC Name | 6-[diethoxy(ethyl)silyl]-2-methylhex-1-en-3-one;bis(6-[diethoxy(methoxy)silyl]-2-methylhex-1-en-3-one) |
| SMILES | C=C(C)C(=O)CCC[Si](CC)(OCC)OCC.C=C(C)C(=O)CCC[Si](OC)(OCC)OCC.C=C(C)C(=O)CCC[Si](OC)(OCC)OCC |
| InChI | InChI=1S/C13H26O3Si.2C12H24O4Si/c1-6-15-17(8-3,16-7-2)11-9-10-13(14)12(4)5;2*1-6-15-17(14-5,16-7-2)10-8-9-12(13)11(3)4/h4,6-11H2,1-3,5H3;2*3,6-10H2,1-2,4-5H3 |
| InChIKey | ALAOCJFXSVOLLD-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.25 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|