C23H32N4O3 — CID 157149546
methyl 6-piperidin-1-ylpyridine-2-carboxylate;(6-piperidin-1-yl-2-pyridinyl)methanol (PubChem CID 157149546) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is methyl 6-piperidin-1-ylpyridine-2-carboxylate;(6-piperidin-1-yl-2-pyridinyl)methanol.
| Compound Name | methyl 6-piperidin-1-ylpyridine-2-carboxylate;(6-piperidin-1-yl-2-pyridinyl)methanol |
|---|---|
| PubChem CID | 157149546 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | methyl 6-piperidin-1-ylpyridine-2-carboxylate;(6-piperidin-1-yl-2-pyridinyl)methanol |
| SMILES | COC(=O)c1cccc(N2CCCCC2)n1.OCc1cccc(N2CCCCC2)n1 |
| InChI | InChI=1S/C12H16N2O2.C11H16N2O/c1-16-12(15)10-6-5-7-11(13-10)14-8-3-2-4-9-14;14-9-10-5-4-6-11(12-10)13-7-2-1-3-8-13/h5-7H,2-4,8-9H2,1H3;4-6,14H,1-3,7-9H2 |
| InChIKey | ALCDIJYBIAECBX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |