About 7-propan-2-yl-2-propyl-3,4-dihydro-1H-isoquinoline
7-propan-2-yl-2-propyl-3,4-dihydro-1H-isoquinoline (PubChem CID 157149924) has the molecular formula C15H23N
and a molecular weight of 217.36 g/mol. Its IUPAC name is 7-propan-2-yl-2-propyl-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | 7-propan-2-yl-2-propyl-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 157149924 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 7-propan-2-yl-2-propyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CCCN1CCc2ccc(C(C)C)cc2C1 |
| InChI | InChI=1S/C15H23N/c1-4-8-16-9-7-13-5-6-14(12(2)3)10-15(13)11-16/h5-6,10,12H,4,7-9,11H2,1-3H3 |
| InChIKey | AGKIKSAKPMNJNJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-propan-2-yl-2-propyl-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propan-2-yl-2-propyl-3,4-dihydro-1H-isoquinoline?
The IUPAC name of 7-propan-2-yl-2-propyl-3,4-dihydro-1H-isoquinoline (CID 157149924) is 7-propan-2-yl-2-propyl-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for 7-propan-2-yl-2-propyl-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for 7-propan-2-yl-2-propyl-3,4-dihydro-1H-isoquinoline is CCCN1CCc2ccc(C(C)C)cc2C1.
What is the InChIKey of 7-propan-2-yl-2-propyl-3,4-dihydro-1H-isoquinoline?
The InChIKey is AGKIKSAKPMNJNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N/c1-4-8-16-9-7-13-5-6-14(12(2)3)10-15(13)11-16/h5-6,10,12H,4,7-9,11H2,1-3H3.
What are the key properties of 7-propan-2-yl-2-propyl-3,4-dihydro-1H-isoquinoline?
7-propan-2-yl-2-propyl-3,4-dihydro-1H-isoquinoline has a molecular weight of 217.36 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propan-2-yl-2-propyl-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 157149924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).