About sodium;methanethiolate;methyl 5-methylsulfanylpyrazine-2-carboxylate
sodium;methanethiolate;methyl 5-methylsulfanylpyrazine-2-carboxylate (PubChem CID 157150138) has the molecular formula C8H11N2NaO2S2
and a molecular weight of 254.31 g/mol. Its IUPAC name is sodium;methanethiolate;methyl 5-methylsulfanylpyrazine-2-carboxylate.
Molecular Properties
| Compound Name | sodium;methanethiolate;methyl 5-methylsulfanylpyrazine-2-carboxylate |
| PubChem CID | 157150138 |
| Molecular Formula | C8H11N2NaO2S2 |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | sodium;methanethiolate;methyl 5-methylsulfanylpyrazine-2-carboxylate |
| SMILES | COC(=O)c1cnc(SC)cn1.C[S-].[Na+] |
| InChI | InChI=1S/C7H8N2O2S.CH4S.Na/c1-11-7(10)5-3-9-6(12-2)4-8-5;1-2;/h3-4H,1-2H3;2H,1H3;/q;;+1/p-1 |
| InChIKey | ALDVRLVEXUKCEP-UHFFFAOYSA-M |
| XLogP | -1.85 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;methanethiolate;methyl 5-methylsulfanylpyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;methanethiolate;methyl 5-methylsulfanylpyrazine-2-carboxylate?
The IUPAC name of sodium;methanethiolate;methyl 5-methylsulfanylpyrazine-2-carboxylate (CID 157150138) is sodium;methanethiolate;methyl 5-methylsulfanylpyrazine-2-carboxylate.
What is the SMILES notation for sodium;methanethiolate;methyl 5-methylsulfanylpyrazine-2-carboxylate?
The canonical SMILES for sodium;methanethiolate;methyl 5-methylsulfanylpyrazine-2-carboxylate is COC(=O)c1cnc(SC)cn1.C[S-].[Na+].
What is the InChIKey of sodium;methanethiolate;methyl 5-methylsulfanylpyrazine-2-carboxylate?
The InChIKey is ALDVRLVEXUKCEP-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8N2O2S.CH4S.Na/c1-11-7(10)5-3-9-6(12-2)4-8-5;1-2;/h3-4H,1-2H3;2H,1H3;/q;;+1/p-1.
What are the key properties of sodium;methanethiolate;methyl 5-methylsulfanylpyrazine-2-carboxylate?
sodium;methanethiolate;methyl 5-methylsulfanylpyrazine-2-carboxylate has a molecular weight of 254.31 g/mol, XLogP of -1.85, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;methanethiolate;methyl 5-methylsulfanylpyrazine-2-carboxylate is sourced from PubChem (CID 157150138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).