C13H21N5 — CID 157151389
N,N,2-trimethyl-6-[(2-methylcyclopenta-1,4-dien-1-yl)methylimino]-2,5-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 157151389) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is N,N,2-trimethyl-6-[(2-methylcyclopenta-1,4-dien-1-yl)methylimino]-2,5-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | N,N,2-trimethyl-6-[(2-methylcyclopenta-1,4-dien-1-yl)methylimino]-2,5-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 157151389 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | N,N,2-trimethyl-6-[(2-methylcyclopenta-1,4-dien-1-yl)methylimino]-2,5-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | CC1=C(C/N=C2\NC(N(C)C)=NC(C)N2)C=CC1 |
| InChI | InChI=1S/C13H21N5/c1-9-6-5-7-11(9)8-14-12-15-10(2)16-13(17-12)18(3)4/h5,7,10H,6,8H2,1-4H3,(H2,14,15,16,17) |
| InChIKey | LMCOCTOSCRADSM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|