C20H34O2 — CID 15715159
(1R,2E,4S,6E,10S)-3,7-dimethyl-10-[(2R)-6-methylhept-5-en-2-yl]cyclodeca-2,6-diene-1,4-diol (PubChem CID 15715159) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (1R,2E,4S,6E,10S)-3,7-dimethyl-10-[(2R)-6-methylhept-5-en-2-yl]cyclodeca-2,6-diene-1,4-diol.
| Compound Name | (1R,2E,4S,6E,10S)-3,7-dimethyl-10-[(2R)-6-methylhept-5-en-2-yl]cyclodeca-2,6-diene-1,4-diol |
|---|---|
| PubChem CID | 15715159 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (1R,2E,4S,6E,10S)-3,7-dimethyl-10-[(2R)-6-methylhept-5-en-2-yl]cyclodeca-2,6-diene-1,4-diol |
| SMILES | CC(C)=CCC[C@@H](C)[C@@H]1CC/C(C)=C/C[C@H](O)/C(C)=C/[C@@H]1O |
| InChI | InChI=1S/C20H34O2/c1-14(2)7-6-8-16(4)18-11-9-15(3)10-12-19(21)17(5)13-20(18)22/h7,10,13,16,18-22H,6,8-9,11-12H2,1-5H3/b15-10+,17-13+/t16-,18+,19+,20+/m1/s1 |
| InChIKey | OXWXNRAARMNGON-YPCCVXNOSA-N |
| XLogP | 4.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|