C18H33N2NaO4S — CID 157151698
sodium;4-carboxy-2,7,7-trimethylnonanoate;1,3-dimethylimidazolidine-2-thione (PubChem CID 157151698) has the molecular formula C18H33N2NaO4S and a molecular weight of 396.53 g/mol. Its IUPAC name is sodium;4-carboxy-2,7,7-trimethylnonanoate;1,3-dimethylimidazolidine-2-thione.
| Compound Name | sodium;4-carboxy-2,7,7-trimethylnonanoate;1,3-dimethylimidazolidine-2-thione |
|---|---|
| PubChem CID | 157151698 |
| Molecular Formula | C18H33N2NaO4S |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | sodium;4-carboxy-2,7,7-trimethylnonanoate;1,3-dimethylimidazolidine-2-thione |
| SMILES | CCC(C)(C)CCC(CC(C)C(=O)[O-])C(=O)O.CN1CCN(C)C1=S.[Na+] |
| InChI | InChI=1S/C13H24O4.C5H10N2S.Na/c1-5-13(3,4)7-6-10(12(16)17)8-9(2)11(14)15;1-6-3-4-7(2)5(6)8;/h9-10H,5-8H2,1-4H3,(H,14,15)(H,16,17);3-4H2,1-2H3;/q;;+1/p-1 |
| InChIKey | ALICREMBVKGCGG-UHFFFAOYSA-M |
| XLogP | -1.17 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|