About 2-methoxy-4,5-dimethylbenzoic acid
2-methoxy-4,5-dimethylbenzoic acid (PubChem CID 15715213) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-methoxy-4,5-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 2-methoxy-4,5-dimethylbenzoic acid |
| PubChem CID | 15715213 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-methoxy-4,5-dimethylbenzoic acid |
| SMILES | COc1cc(C)c(C)cc1C(=O)O |
| InChI | InChI=1S/C10H12O3/c1-6-4-8(10(11)12)9(13-3)5-7(6)2/h4-5H,1-3H3,(H,11,12) |
| InChIKey | HATRJAVAPAPTBH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-4,5-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4,5-dimethylbenzoic acid?
The IUPAC name of 2-methoxy-4,5-dimethylbenzoic acid (CID 15715213) is 2-methoxy-4,5-dimethylbenzoic acid.
What is the SMILES notation for 2-methoxy-4,5-dimethylbenzoic acid?
The canonical SMILES for 2-methoxy-4,5-dimethylbenzoic acid is COc1cc(C)c(C)cc1C(=O)O.
What is the InChIKey of 2-methoxy-4,5-dimethylbenzoic acid?
The InChIKey is HATRJAVAPAPTBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-6-4-8(10(11)12)9(13-3)5-7(6)2/h4-5H,1-3H3,(H,11,12).
What are the key properties of 2-methoxy-4,5-dimethylbenzoic acid?
2-methoxy-4,5-dimethylbenzoic acid has a molecular weight of 180.20 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4,5-dimethylbenzoic acid is sourced from PubChem (CID 15715213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).