C28H28Cl2N6O7S2 — CID 157152187
4-[[3-chloro-4-(hydroxymethyl)phenyl]methylamino]-2-methylsulfanylpyrimidine-5-carboxylic acid;4-[[3-chloro-4-(hydroxymethyl)phenyl]methylamino]-2-methylsulfinylpyrimidine-5-carboxylic acid (PubChem CID 157152187) has the molecular formula C28H28Cl2N6O7S2 and a molecular weight of 695.61 g/mol. Its IUPAC name is 4-[[3-chloro-4-(hydroxymethyl)phenyl]methylamino]-2-methylsulfanylpyrimidine-5-carboxylic acid;4-[[3-chloro-4-(hydroxymethyl)phenyl]methylamino]-2-methylsulfinylpyrimidine-5-carboxylic acid.
| Compound Name | 4-[[3-chloro-4-(hydroxymethyl)phenyl]methylamino]-2-methylsulfanylpyrimidine-5-carboxylic acid;4-[[3-chloro-4-(hydroxymethyl)phenyl]methylamino]-2-methylsulfinylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 157152187 |
| Molecular Formula | C28H28Cl2N6O7S2 |
| Molecular Weight | 695.61 g/mol |
| Exact Mass | 694.08 |
| IUPAC Name | 4-[[3-chloro-4-(hydroxymethyl)phenyl]methylamino]-2-methylsulfanylpyrimidine-5-carboxylic acid;4-[[3-chloro-4-(hydroxymethyl)phenyl]methylamino]-2-methylsulfinylpyrimidine-5-carboxylic acid |
| SMILES | CS(=O)c1ncc(C(=O)O)c(NCc2ccc(CO)c(Cl)c2)n1.CSc1ncc(C(=O)O)c(NCc2ccc(CO)c(Cl)c2)n1 |
| InChI | InChI=1S/C14H14ClN3O4S.C14H14ClN3O3S/c1-23(22)14-17-6-10(13(20)21)12(18-14)16-5-8-2-3-9(7-19)11(15)4-8;1-22-14-17-6-10(13(20)21)12(18-14)16-5-8-2-3-9(7-19)11(15)4-8/h2-4,6,19H,5,7H2,1H3,(H,20,21)(H,16,17,18);2-4,6,19H,5,7H2,1H3,(H,20,21)(H,16,17,18) |
| InChIKey | ALJQXVSPDDULQX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 207.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |