C24H16FN3O — CID 157152229
8-ethynyl-6-(2-fluorophenyl)-3-(3-methylfuran-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepine (PubChem CID 157152229) has the molecular formula C24H16FN3O and a molecular weight of 381.41 g/mol. Its IUPAC name is 8-ethynyl-6-(2-fluorophenyl)-3-(3-methylfuran-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepine.
| Compound Name | 8-ethynyl-6-(2-fluorophenyl)-3-(3-methylfuran-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 157152229 |
| Molecular Formula | C24H16FN3O |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 8-ethynyl-6-(2-fluorophenyl)-3-(3-methylfuran-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepine |
| SMILES | C#Cc1ccc2c(c1)C(c1ccccc1F)=NCc1c(-c3occc3C)ncn1-2 |
| InChI | InChI=1S/C24H16FN3O/c1-3-16-8-9-20-18(12-16)22(17-6-4-5-7-19(17)25)26-13-21-23(27-14-28(20)21)24-15(2)10-11-29-24/h1,4-12,14H,13H2,2H3 |
| InChIKey | IOYGQGHTASBWRK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 43.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|