C46H24F24O4 — CID 157153259
2,5-bis[3,5-bis(trifluoromethyl)phenyl]benzene-1,4-diol;1,4-bis[3,5-bis(trifluoromethyl)phenyl]-2,5-dimethoxybenzene (PubChem CID 157153259) has the molecular formula C46H24F24O4 and a molecular weight of 1096.65 g/mol. Its IUPAC name is 2,5-bis[3,5-bis(trifluoromethyl)phenyl]benzene-1,4-diol;1,4-bis[3,5-bis(trifluoromethyl)phenyl]-2,5-dimethoxybenzene.
| Compound Name | 2,5-bis[3,5-bis(trifluoromethyl)phenyl]benzene-1,4-diol;1,4-bis[3,5-bis(trifluoromethyl)phenyl]-2,5-dimethoxybenzene |
|---|---|
| PubChem CID | 157153259 |
| Molecular Formula | C46H24F24O4 |
| Molecular Weight | 1096.65 g/mol |
| Exact Mass | 1096.13 |
| IUPAC Name | 2,5-bis[3,5-bis(trifluoromethyl)phenyl]benzene-1,4-diol;1,4-bis[3,5-bis(trifluoromethyl)phenyl]-2,5-dimethoxybenzene |
| SMILES | COc1cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(OC)cc1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1.Oc1cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(O)cc1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H14F12O2.C22H10F12O2/c1-37-19-9-18(12-5-15(23(31,32)33)8-16(6-12)24(34,35)36)20(38-2)10-17(19)11-3-13(21(25,26)27)7-14(4-11)22(28,29)30;23-19(24,25)11-1-9(2-12(5-11)20(26,27)28)15-7-18(36)16(8-17(15)35)10-3-13(21(29,30)31)6-14(4-10)22(32,33)34/h3-10H,1-2H3;1-8,35-36H |
| InChIKey | ALMVRAZQLIXVOK-UHFFFAOYSA-N |
| XLogP | 17.62 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1096.65 |
| LogP ≤ 5 | 17.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|