About 7-hydroxy-2-methoxy-9H-carbazole-1,6-dicarbaldehyde
7-hydroxy-2-methoxy-9H-carbazole-1,6-dicarbaldehyde (PubChem CID 15715327) has the molecular formula C15H11NO4
and a molecular weight of 269.26 g/mol. Its IUPAC name is 7-hydroxy-2-methoxy-9H-carbazole-1,6-dicarbaldehyde.
Molecular Properties
| Compound Name | 7-hydroxy-2-methoxy-9H-carbazole-1,6-dicarbaldehyde |
| PubChem CID | 15715327 |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 7-hydroxy-2-methoxy-9H-carbazole-1,6-dicarbaldehyde |
| SMILES | COc1ccc2c([nH]c3cc(O)c(C=O)cc32)c1C=O |
| InChI | InChI=1S/C15H11NO4/c1-20-14-3-2-9-10-4-8(6-17)13(19)5-12(10)16-15(9)11(14)7-18/h2-7,16,19H,1H3 |
| InChIKey | VPSFJNOVIVVIKA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-2-methoxy-9H-carbazole-1,6-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-2-methoxy-9H-carbazole-1,6-dicarbaldehyde?
The IUPAC name of 7-hydroxy-2-methoxy-9H-carbazole-1,6-dicarbaldehyde (CID 15715327) is 7-hydroxy-2-methoxy-9H-carbazole-1,6-dicarbaldehyde.
What is the SMILES notation for 7-hydroxy-2-methoxy-9H-carbazole-1,6-dicarbaldehyde?
The canonical SMILES for 7-hydroxy-2-methoxy-9H-carbazole-1,6-dicarbaldehyde is COc1ccc2c([nH]c3cc(O)c(C=O)cc32)c1C=O.
What is the InChIKey of 7-hydroxy-2-methoxy-9H-carbazole-1,6-dicarbaldehyde?
The InChIKey is VPSFJNOVIVVIKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO4/c1-20-14-3-2-9-10-4-8(6-17)13(19)5-12(10)16-15(9)11(14)7-18/h2-7,16,19H,1H3.
What are the key properties of 7-hydroxy-2-methoxy-9H-carbazole-1,6-dicarbaldehyde?
7-hydroxy-2-methoxy-9H-carbazole-1,6-dicarbaldehyde has a molecular weight of 269.26 g/mol, XLogP of 2.66, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-2-methoxy-9H-carbazole-1,6-dicarbaldehyde is sourced from PubChem (CID 15715327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).