C18H16F2N4O2S — CID 157153562
(6S)-N-(3,4-difluoro-5-methylphenyl)-6-methyl-3-(1,3-thiazol-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxamide (PubChem CID 157153562) has the molecular formula C18H16F2N4O2S and a molecular weight of 390.42 g/mol. Its IUPAC name is (6S)-N-(3,4-difluoro-5-methylphenyl)-6-methyl-3-(1,3-thiazol-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxamide.
| Compound Name | (6S)-N-(3,4-difluoro-5-methylphenyl)-6-methyl-3-(1,3-thiazol-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 157153562 |
| Molecular Formula | C18H16F2N4O2S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | (6S)-N-(3,4-difluoro-5-methylphenyl)-6-methyl-3-(1,3-thiazol-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxamide |
| SMILES | Cc1cc(NC(=O)N2Cc3c(noc3-c3cscn3)C[C@@H]2C)cc(F)c1F |
| InChI | InChI=1S/C18H16F2N4O2S/c1-9-3-11(5-13(19)16(9)20)22-18(25)24-6-12-14(4-10(24)2)23-26-17(12)15-7-27-8-21-15/h3,5,7-8,10H,4,6H2,1-2H3,(H,22,25)/t10-/m0/s1 |
| InChIKey | YESMLNHZZUOJRD-JTQLQIEISA-N |
| XLogP | 4.36 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |