About (2,2-dimethyl-4-oxo-7-phenylmethoxy-1,3-benzodioxin-5-yl) trifluoromethanesulfonate
(2,2-dimethyl-4-oxo-7-phenylmethoxy-1,3-benzodioxin-5-yl) trifluoromethanesulfonate (PubChem CID 15715411) has the molecular formula C18H15F3O7S
and a molecular weight of 432.37 g/mol. Its IUPAC name is (2,2-dimethyl-4-oxo-7-phenylmethoxy-1,3-benzodioxin-5-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (2,2-dimethyl-4-oxo-7-phenylmethoxy-1,3-benzodioxin-5-yl) trifluoromethanesulfonate |
| PubChem CID | 15715411 |
| Molecular Formula | C18H15F3O7S |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | (2,2-dimethyl-4-oxo-7-phenylmethoxy-1,3-benzodioxin-5-yl) trifluoromethanesulfonate |
| SMILES | CC1(C)OC(=O)c2c(cc(OCc3ccccc3)cc2OS(=O)(=O)C(F)(F)F)O1 |
| InChI | InChI=1S/C18H15F3O7S/c1-17(2)26-13-8-12(25-10-11-6-4-3-5-7-11)9-14(15(13)16(22)27-17)28-29(23,24)18(19,20)21/h3-9H,10H2,1-2H3 |
| InChIKey | BJIQUQJTTKQWCR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethyl-4-oxo-7-phenylmethoxy-1,3-benzodioxin-5-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-4-oxo-7-phenylmethoxy-1,3-benzodioxin-5-yl) trifluoromethanesulfonate?
The IUPAC name of (2,2-dimethyl-4-oxo-7-phenylmethoxy-1,3-benzodioxin-5-yl) trifluoromethanesulfonate (CID 15715411) is (2,2-dimethyl-4-oxo-7-phenylmethoxy-1,3-benzodioxin-5-yl) trifluoromethanesulfonate.
What is the SMILES notation for (2,2-dimethyl-4-oxo-7-phenylmethoxy-1,3-benzodioxin-5-yl) trifluoromethanesulfonate?
The canonical SMILES for (2,2-dimethyl-4-oxo-7-phenylmethoxy-1,3-benzodioxin-5-yl) trifluoromethanesulfonate is CC1(C)OC(=O)c2c(cc(OCc3ccccc3)cc2OS(=O)(=O)C(F)(F)F)O1.
What is the InChIKey of (2,2-dimethyl-4-oxo-7-phenylmethoxy-1,3-benzodioxin-5-yl) trifluoromethanesulfonate?
The InChIKey is BJIQUQJTTKQWCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F3O7S/c1-17(2)26-13-8-12(25-10-11-6-4-3-5-7-11)9-14(15(13)16(22)27-17)28-29(23,24)18(19,20)21/h3-9H,10H2,1-2H3.
What are the key properties of (2,2-dimethyl-4-oxo-7-phenylmethoxy-1,3-benzodioxin-5-yl) trifluoromethanesulfonate?
(2,2-dimethyl-4-oxo-7-phenylmethoxy-1,3-benzodioxin-5-yl) trifluoromethanesulfonate has a molecular weight of 432.37 g/mol, XLogP of 3.78, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-4-oxo-7-phenylmethoxy-1,3-benzodioxin-5-yl) trifluoromethanesulfonate is sourced from PubChem (CID 15715411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).