C10H19F4NO2 — CID 157155087
2,2,4,4-tetrafluoro-N-[2-(2-methoxyethoxy)ethyl]pentan-1-amine (PubChem CID 157155087) has the molecular formula C10H19F4NO2 and a molecular weight of 261.26 g/mol. Its IUPAC name is 2,2,4,4-tetrafluoro-N-[2-(2-methoxyethoxy)ethyl]pentan-1-amine.
| Compound Name | 2,2,4,4-tetrafluoro-N-[2-(2-methoxyethoxy)ethyl]pentan-1-amine |
|---|---|
| PubChem CID | 157155087 |
| Molecular Formula | C10H19F4NO2 |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 2,2,4,4-tetrafluoro-N-[2-(2-methoxyethoxy)ethyl]pentan-1-amine |
| SMILES | COCCOCCNCC(F)(F)CC(C)(F)F |
| InChI | InChI=1S/C10H19F4NO2/c1-9(11,12)7-10(13,14)8-15-3-4-17-6-5-16-2/h15H,3-8H2,1-2H3 |
| InChIKey | MTESENYJDGZWSE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|