About CID 157155645
CID 157155645 (PubChem CID 157155645) has the molecular formula C28H22BBrF2N5O4S3
and a molecular weight of 717.43 g/mol.
Molecular Properties
| Compound Name | CID 157155645 |
| PubChem CID | 157155645 |
| Molecular Formula | C28H22BBrF2N5O4S3 |
| Molecular Weight | 717.43 g/mol |
| Exact Mass | 716.01 |
| IUPAC Name | — |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(Br)c3cc(F)cnc32)cc1.Cc1ccc(S(=O)(=O)n2ccc3cc(F)cnc32)cc1.[B]=NS |
| InChI | InChI=1S/C14H10BrFN2O2S.C14H11FN2O2S.BHNS/c1-9-2-4-11(5-3-9)21(19,20)18-8-13(15)12-6-10(16)7-17-14(12)18;1-10-2-4-13(5-3-10)20(18,19)17-7-6-11-8-12(15)9-16-14(11)17;1-2-3/h2-8H,1H3;2-9H,1H3;3H |
| InChIKey | ZSLWAXVQWGJXQN-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 717.43 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 157155645 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157155645?
The IUPAC name of CID 157155645 (CID 157155645) is not available.
What is the SMILES notation for CID 157155645?
The canonical SMILES for CID 157155645 is Cc1ccc(S(=O)(=O)n2cc(Br)c3cc(F)cnc32)cc1.Cc1ccc(S(=O)(=O)n2ccc3cc(F)cnc32)cc1.[B]=NS.
What is the InChIKey of CID 157155645?
The InChIKey is ZSLWAXVQWGJXQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrFN2O2S.C14H11FN2O2S.BHNS/c1-9-2-4-11(5-3-9)21(19,20)18-8-13(15)12-6-10(16)7-17-14(12)18;1-10-2-4-13(5-3-10)20(18,19)17-7-6-11-8-12(15)9-16-14(11)17;1-2-3/h2-8H,1H3;2-9H,1H3;3H.
What are the key properties of CID 157155645?
CID 157155645 has a molecular weight of 717.43 g/mol, XLogP of 6.39, 4 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157155645 is sourced from PubChem (CID 157155645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).