C20H32O — CID 15715612
(3S,4aS,6aS,10aS,10bR)-3-ethenyl-3,4a,7,7,10a-pentamethyl-2,6a,8,9,10,10b-hexahydro-1H-benzo[f]chromene (PubChem CID 15715612) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (3S,4aS,6aS,10aS,10bR)-3-ethenyl-3,4a,7,7,10a-pentamethyl-2,6a,8,9,10,10b-hexahydro-1H-benzo[f]chromene.
| Compound Name | (3S,4aS,6aS,10aS,10bR)-3-ethenyl-3,4a,7,7,10a-pentamethyl-2,6a,8,9,10,10b-hexahydro-1H-benzo[f]chromene |
|---|---|
| PubChem CID | 15715612 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (3S,4aS,6aS,10aS,10bR)-3-ethenyl-3,4a,7,7,10a-pentamethyl-2,6a,8,9,10,10b-hexahydro-1H-benzo[f]chromene |
| SMILES | C=C[C@]1(C)CC[C@@H]2[C@@]3(C)CCCC(C)(C)[C@@H]3C=C[C@]2(C)O1 |
| InChI | InChI=1S/C20H32O/c1-7-18(4)13-9-16-19(5)12-8-11-17(2,3)15(19)10-14-20(16,6)21-18/h7,10,14-16H,1,8-9,11-13H2,2-6H3/t15-,16+,18+,19-,20-/m0/s1 |
| InChIKey | LGZGZUXGOFLQOU-NXHKRRBXSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|