C21H34O7 — CID 157156479
(3aR,5R,6S,6aR)-2,2-dimethyl-5-prop-2-enyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol;(3aR,5R,6S,6aR)-2,2,6-trimethyl-5-prop-2-enyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 157156479) has the molecular formula C21H34O7 and a molecular weight of 398.50 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-2,2-dimethyl-5-prop-2-enyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol;(3aR,5R,6S,6aR)-2,2,6-trimethyl-5-prop-2-enyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-2,2-dimethyl-5-prop-2-enyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol;(3aR,5R,6S,6aR)-2,2,6-trimethyl-5-prop-2-enyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 157156479 |
| Molecular Formula | C21H34O7 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (3aR,5R,6S,6aR)-2,2-dimethyl-5-prop-2-enyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol;(3aR,5R,6S,6aR)-2,2,6-trimethyl-5-prop-2-enyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | C=CC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1C.C=CC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C11H18O3.C10H16O4/c1-5-6-8-7(2)9-10(12-8)14-11(3,4)13-9;1-4-5-6-7(11)8-9(12-6)14-10(2,3)13-8/h5,7-10H,1,6H2,2-4H3;4,6-9,11H,1,5H2,2-3H3/t7-,8+,9+,10+;6-,7+,8-,9-/m01/s1 |
| InChIKey | ALWFJUOVOQKBSD-SSAPRQSRSA-N |
| XLogP | 2.87 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|