C20H28N2O2S3 — CID 157156570
1-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-10-sulfanyldecane-1,9-dione (PubChem CID 157156570) has the molecular formula C20H28N2O2S3 and a molecular weight of 424.66 g/mol. Its IUPAC name is 1-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-10-sulfanyldecane-1,9-dione.
| Compound Name | 1-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-10-sulfanyldecane-1,9-dione |
|---|---|
| PubChem CID | 157156570 |
| Molecular Formula | C20H28N2O2S3 |
| Molecular Weight | 424.66 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 1-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-10-sulfanyldecane-1,9-dione |
| SMILES | CC(C)Cc1sc(-c2nccs2)nc1C(=O)CCCCCCCC(=O)CS |
| InChI | InChI=1S/C20H28N2O2S3/c1-14(2)12-17-18(22-20(27-17)19-21-10-11-26-19)16(24)9-7-5-3-4-6-8-15(23)13-25/h10-11,14,25H,3-9,12-13H2,1-2H3 |
| InChIKey | ALWLLMSGDSDJPW-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.66 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|