C18H17BN3+ — CID 157158154
3,18-dimethyl-2,5-diaza-18-azonia-1-borapentacyclo[10.7.1.02,6.08,20.014,19]icosa-3,5,8,10,12(20),14(19),15,17-octaene (PubChem CID 157158154) has the molecular formula C18H17BN3+ and a molecular weight of 286.17 g/mol. Its IUPAC name is 3,18-dimethyl-2,5-diaza-18-azonia-1-borapentacyclo[10.7.1.02,6.08,20.014,19]icosa-3,5,8,10,12(20),14(19),15,17-octaene.
| Compound Name | 3,18-dimethyl-2,5-diaza-18-azonia-1-borapentacyclo[10.7.1.02,6.08,20.014,19]icosa-3,5,8,10,12(20),14(19),15,17-octaene |
|---|---|
| PubChem CID | 157158154 |
| Molecular Formula | C18H17BN3+ |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3,18-dimethyl-2,5-diaza-18-azonia-1-borapentacyclo[10.7.1.02,6.08,20.014,19]icosa-3,5,8,10,12(20),14(19),15,17-octaene |
| SMILES | Cc1cnc2n1B1c3c(cccc3C2)Cc2ccc[n+](C)c21 |
| InChI | InChI=1S/C18H17BN3/c1-12-11-20-16-10-14-6-3-5-13-9-15-7-4-8-21(2)18(15)19(17(13)14)22(12)16/h3-8,11H,9-10H2,1-2H3/q+1 |
| InChIKey | VVCAEFXQVJIMLF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|