About 2-hydroxy-3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one
2-hydroxy-3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one (PubChem CID 15715943) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-hydroxy-3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 2-hydroxy-3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one |
| PubChem CID | 15715943 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2-hydroxy-3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one |
| SMILES | C=C1C(C)=C(O)C(=O)CC1(C)C |
| InChI | InChI=1S/C10H14O2/c1-6-7(2)10(3,4)5-8(11)9(6)12/h12H,2,5H2,1,3-4H3 |
| InChIKey | LTFSHRILVMNKDN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxy-3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one?
The IUPAC name of 2-hydroxy-3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one (CID 15715943) is 2-hydroxy-3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one.
What is the SMILES notation for 2-hydroxy-3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one?
The canonical SMILES for 2-hydroxy-3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one is C=C1C(C)=C(O)C(=O)CC1(C)C.
What is the InChIKey of 2-hydroxy-3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one?
The InChIKey is LTFSHRILVMNKDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-6-7(2)10(3,4)5-8(11)9(6)12/h12H,2,5H2,1,3-4H3.
What are the key properties of 2-hydroxy-3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one?
2-hydroxy-3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one has a molecular weight of 166.22 g/mol, XLogP of 2.37, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one is sourced from PubChem (CID 15715943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).