C13H22O — CID 15715946
3-[(E)-but-1-enyl]-2,4,4-trimethylcyclohex-2-en-1-ol (PubChem CID 15715946) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 3-[(E)-but-1-enyl]-2,4,4-trimethylcyclohex-2-en-1-ol.
| Compound Name | 3-[(E)-but-1-enyl]-2,4,4-trimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 15715946 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 3-[(E)-but-1-enyl]-2,4,4-trimethylcyclohex-2-en-1-ol |
| SMILES | CC/C=C/C1=C(C)C(O)CCC1(C)C |
| InChI | InChI=1S/C13H22O/c1-5-6-7-11-10(2)12(14)8-9-13(11,3)4/h6-7,12,14H,5,8-9H2,1-4H3/b7-6+ |
| InChIKey | SPJJJLMGNIWHRG-VOTSOKGWSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |