C26H52N2O5 — CID 157159516
4-tert-butyl-1-hydroxy-2,2,6,6-tetramethylpiperidine;(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) propan-2-yl carbonate (PubChem CID 157159516) has the molecular formula C26H52N2O5 and a molecular weight of 472.71 g/mol. Its IUPAC name is 4-tert-butyl-1-hydroxy-2,2,6,6-tetramethylpiperidine;(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) propan-2-yl carbonate.
| Compound Name | 4-tert-butyl-1-hydroxy-2,2,6,6-tetramethylpiperidine;(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) propan-2-yl carbonate |
|---|---|
| PubChem CID | 157159516 |
| Molecular Formula | C26H52N2O5 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.39 |
| IUPAC Name | 4-tert-butyl-1-hydroxy-2,2,6,6-tetramethylpiperidine;(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) propan-2-yl carbonate |
| SMILES | CC(C)(C)C1CC(C)(C)N(O)C(C)(C)C1.CC(C)OC(=O)OC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C13H25NO4.C13H27NO/c1-9(2)17-11(15)18-10-7-12(3,4)14(16)13(5,6)8-10;1-11(2,3)10-8-12(4,5)14(15)13(6,7)9-10/h9-10,16H,7-8H2,1-6H3;10,15H,8-9H2,1-7H3 |
| InChIKey | SMYTZROROIUBGC-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |