About CID 157159817
CID 157159817 (PubChem CID 157159817) has the molecular formula C38H27BF12N8O3
and a molecular weight of 882.47 g/mol.
Molecular Properties
| Compound Name | CID 157159817 |
| PubChem CID | 157159817 |
| Molecular Formula | C38H27BF12N8O3 |
| Molecular Weight | 882.47 g/mol |
| Exact Mass | 882.21 |
| IUPAC Name | — |
| SMILES | Cn1nc(C(F)(F)F)cc1-c1ccc(NC(=O)c2c(F)ccc(F)c2F)nc1.Cn1nc(C(F)(F)F)cc1-c1ccc(NC(=O)c2c(F)ccc(F)c2F)nc1.[B]C1CCCO1 |
| InChI | InChI=1S/2C17H10F6N4O.C4H7BO/c2*1-27-11(6-12(26-27)17(21,22)23)8-2-5-13(24-7-8)25-16(28)14-9(18)3-4-10(19)15(14)20;5-4-2-1-3-6-4/h2*2-7H,1H3,(H,24,25,28);4H,1-3H2 |
| InChIKey | ZGSHRGFQLMJRPD-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 128.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 882.47 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 157159817 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157159817?
The IUPAC name of CID 157159817 (CID 157159817) is not available.
What is the SMILES notation for CID 157159817?
The canonical SMILES for CID 157159817 is Cn1nc(C(F)(F)F)cc1-c1ccc(NC(=O)c2c(F)ccc(F)c2F)nc1.Cn1nc(C(F)(F)F)cc1-c1ccc(NC(=O)c2c(F)ccc(F)c2F)nc1.[B]C1CCCO1.
What is the InChIKey of CID 157159817?
The InChIKey is ZGSHRGFQLMJRPD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C17H10F6N4O.C4H7BO/c2*1-27-11(6-12(26-27)17(21,22)23)8-2-5-13(24-7-8)25-16(28)14-9(18)3-4-10(19)15(14)20;5-4-2-1-3-6-4/h2*2-7H,1H3,(H,24,25,28);4H,1-3H2.
What are the key properties of CID 157159817?
CID 157159817 has a molecular weight of 882.47 g/mol, XLogP of 8.63, 6 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157159817 is sourced from PubChem (CID 157159817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).