About CID 157160328
CID 157160328 (PubChem CID 157160328) has the molecular formula C20H15BiO6
and a molecular weight of 560.31 g/mol.
Molecular Properties
| Compound Name | CID 157160328 |
|---|
| PubChem CID | 157160328 |
|---|
| Molecular Formula | C20H15BiO6 |
|---|
| Molecular Weight | 560.31 g/mol |
|---|
| Exact Mass | 560.07 |
|---|
| IUPAC Name | — |
|---|
| SMILES | O=C(O)c1ccc([O-])cc1.O=C(O)c1ccc([O-])cc1.[Bi+2]c1ccccc1 |
|---|
| InChI | InChI=1S/2C7H6O3.C6H5.Bi/c2*8-6-3-1-5(2-4-6)7(9)10;1-2-4-6-5-3-1;/h2*1-4,8H,(H,9,10);1-5H;/q;;;+2/p-2 |
|---|
| InChIKey | AMHKUCNWOUVTRU-UHFFFAOYSA-L |
|---|
| XLogP | 1.40 |
|---|
| TPSA | 120.72 Ų |
|---|
| H-Bond Donors | 2 |
|---|
| H-Bond Acceptors | 4 |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 27 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
1 violation
| Rule | Value |
|---|
| MW ≤ 500 | 560.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 157160328 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157160328?
The IUPAC name of CID 157160328 (CID 157160328) is not available.
What is the SMILES notation for CID 157160328?
The canonical SMILES for CID 157160328 is O=C(O)c1ccc([O-])cc1.O=C(O)c1ccc([O-])cc1.[Bi+2]c1ccccc1.
What is the InChIKey of CID 157160328?
The InChIKey is AMHKUCNWOUVTRU-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H6O3.C6H5.Bi/c2*8-6-3-1-5(2-4-6)7(9)10;1-2-4-6-5-3-1;/h2*1-4,8H,(H,9,10);1-5H;/q;;;+2/p-2.
What are the key properties of CID 157160328?
CID 157160328 has a molecular weight of 560.31 g/mol, XLogP of 1.40, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157160328 is sourced from PubChem (CID 157160328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).