C19H27BrN2O3 — CID 157162137
1-bromobutane;1-(2-cyclohexylethyl)pyrido[2,3-d][1,3]oxazine-2,4-dione (PubChem CID 157162137) has the molecular formula C19H27BrN2O3 and a molecular weight of 411.34 g/mol. Its IUPAC name is 1-bromobutane;1-(2-cyclohexylethyl)pyrido[2,3-d][1,3]oxazine-2,4-dione.
| Compound Name | 1-bromobutane;1-(2-cyclohexylethyl)pyrido[2,3-d][1,3]oxazine-2,4-dione |
|---|---|
| PubChem CID | 157162137 |
| Molecular Formula | C19H27BrN2O3 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1-bromobutane;1-(2-cyclohexylethyl)pyrido[2,3-d][1,3]oxazine-2,4-dione |
| SMILES | CCCCBr.O=c1oc(=O)n(CCC2CCCCC2)c2ncccc12 |
| InChI | InChI=1S/C15H18N2O3.C4H9Br/c18-14-12-7-4-9-16-13(12)17(15(19)20-14)10-8-11-5-2-1-3-6-11;1-2-3-4-5/h4,7,9,11H,1-3,5-6,8,10H2;2-4H2,1H3 |
| InChIKey | AMMQJHYXBCQPLV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|