About formamide;4-methyl-1,3-dioxolan-2-one
formamide;4-methyl-1,3-dioxolan-2-one (PubChem CID 157162326) has the molecular formula C5H9NO4
and a molecular weight of 147.13 g/mol. Its IUPAC name is formamide;4-methyl-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | formamide;4-methyl-1,3-dioxolan-2-one |
| PubChem CID | 157162326 |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | formamide;4-methyl-1,3-dioxolan-2-one |
| SMILES | CC1COC(=O)O1.NC=O |
| InChI | InChI=1S/C4H6O3.CH3NO/c1-3-2-6-4(5)7-3;2-1-3/h3H,2H2,1H3;1H,(H2,2,3) |
| InChIKey | AMNDOTNHMJUZDI-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formamide;4-methyl-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formamide;4-methyl-1,3-dioxolan-2-one?
The IUPAC name of formamide;4-methyl-1,3-dioxolan-2-one (CID 157162326) is formamide;4-methyl-1,3-dioxolan-2-one.
What is the SMILES notation for formamide;4-methyl-1,3-dioxolan-2-one?
The canonical SMILES for formamide;4-methyl-1,3-dioxolan-2-one is CC1COC(=O)O1.NC=O.
What is the InChIKey of formamide;4-methyl-1,3-dioxolan-2-one?
The InChIKey is AMNDOTNHMJUZDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3.CH3NO/c1-3-2-6-4(5)7-3;2-1-3/h3H,2H2,1H3;1H,(H2,2,3).
What are the key properties of formamide;4-methyl-1,3-dioxolan-2-one?
formamide;4-methyl-1,3-dioxolan-2-one has a molecular weight of 147.13 g/mol, XLogP of -0.36, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formamide;4-methyl-1,3-dioxolan-2-one is sourced from PubChem (CID 157162326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).