About 4-methylbenzoic acid;4-methylbenzoyl chloride;4-(4-methylphenyl)-1H-tetrazol-5-one
4-methylbenzoic acid;4-methylbenzoyl chloride;4-(4-methylphenyl)-1H-tetrazol-5-one (PubChem CID 157162503) has the molecular formula C24H23ClN4O4
and a molecular weight of 466.93 g/mol. Its IUPAC name is 4-methylbenzoic acid;4-methylbenzoyl chloride;4-(4-methylphenyl)-1H-tetrazol-5-one.
Molecular Properties
| Compound Name | 4-methylbenzoic acid;4-methylbenzoyl chloride;4-(4-methylphenyl)-1H-tetrazol-5-one |
| PubChem CID | 157162503 |
| Molecular Formula | C24H23ClN4O4 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 4-methylbenzoic acid;4-methylbenzoyl chloride;4-(4-methylphenyl)-1H-tetrazol-5-one |
| SMILES | Cc1ccc(-n2nn[nH]c2=O)cc1.Cc1ccc(C(=O)Cl)cc1.Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H7ClO.C8H8N4O.C8H8O2/c1-6-2-4-7(5-3-6)8(9)10;1-6-2-4-7(5-3-6)12-8(13)9-10-11-12;1-6-2-4-7(5-3-6)8(9)10/h2-5H,1H3;2-5H,1H3,(H,9,11,13);2-5H,1H3,(H,9,10) |
| InChIKey | AMNPNSFGMQBBCS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzoic acid;4-methylbenzoyl chloride;4-(4-methylphenyl)-1H-tetrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzoic acid;4-methylbenzoyl chloride;4-(4-methylphenyl)-1H-tetrazol-5-one?
The IUPAC name of 4-methylbenzoic acid;4-methylbenzoyl chloride;4-(4-methylphenyl)-1H-tetrazol-5-one (CID 157162503) is 4-methylbenzoic acid;4-methylbenzoyl chloride;4-(4-methylphenyl)-1H-tetrazol-5-one.
What is the SMILES notation for 4-methylbenzoic acid;4-methylbenzoyl chloride;4-(4-methylphenyl)-1H-tetrazol-5-one?
The canonical SMILES for 4-methylbenzoic acid;4-methylbenzoyl chloride;4-(4-methylphenyl)-1H-tetrazol-5-one is Cc1ccc(-n2nn[nH]c2=O)cc1.Cc1ccc(C(=O)Cl)cc1.Cc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-methylbenzoic acid;4-methylbenzoyl chloride;4-(4-methylphenyl)-1H-tetrazol-5-one?
The InChIKey is AMNPNSFGMQBBCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO.C8H8N4O.C8H8O2/c1-6-2-4-7(5-3-6)8(9)10;1-6-2-4-7(5-3-6)12-8(13)9-10-11-12;1-6-2-4-7(5-3-6)8(9)10/h2-5H,1H3;2-5H,1H3,(H,9,11,13);2-5H,1H3,(H,9,10).
What are the key properties of 4-methylbenzoic acid;4-methylbenzoyl chloride;4-(4-methylphenyl)-1H-tetrazol-5-one?
4-methylbenzoic acid;4-methylbenzoyl chloride;4-(4-methylphenyl)-1H-tetrazol-5-one has a molecular weight of 466.93 g/mol, XLogP of 4.33, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzoic acid;4-methylbenzoyl chloride;4-(4-methylphenyl)-1H-tetrazol-5-one is sourced from PubChem (CID 157162503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).