About 2-(methylamino)ethanesulfonic acid;4-methylmorpholine
2-(methylamino)ethanesulfonic acid;4-methylmorpholine (PubChem CID 157164072) has the molecular formula C8H20N2O4S
and a molecular weight of 240.32 g/mol. Its IUPAC name is 2-(methylamino)ethanesulfonic acid;4-methylmorpholine.
Molecular Properties
| Compound Name | 2-(methylamino)ethanesulfonic acid;4-methylmorpholine |
| PubChem CID | 157164072 |
| Molecular Formula | C8H20N2O4S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-(methylamino)ethanesulfonic acid;4-methylmorpholine |
| SMILES | CN1CCOCC1.CNCCS(=O)(=O)O |
| InChI | InChI=1S/C5H11NO.C3H9NO3S/c1-6-2-4-7-5-3-6;1-4-2-3-8(5,6)7/h2-5H2,1H3;4H,2-3H2,1H3,(H,5,6,7) |
| InChIKey | AMRZORKDPUUMED-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylamino)ethanesulfonic acid;4-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)ethanesulfonic acid;4-methylmorpholine?
The IUPAC name of 2-(methylamino)ethanesulfonic acid;4-methylmorpholine (CID 157164072) is 2-(methylamino)ethanesulfonic acid;4-methylmorpholine.
What is the SMILES notation for 2-(methylamino)ethanesulfonic acid;4-methylmorpholine?
The canonical SMILES for 2-(methylamino)ethanesulfonic acid;4-methylmorpholine is CN1CCOCC1.CNCCS(=O)(=O)O.
What is the InChIKey of 2-(methylamino)ethanesulfonic acid;4-methylmorpholine?
The InChIKey is AMRZORKDPUUMED-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C3H9NO3S/c1-6-2-4-7-5-3-6;1-4-2-3-8(5,6)7/h2-5H2,1H3;4H,2-3H2,1H3,(H,5,6,7).
What are the key properties of 2-(methylamino)ethanesulfonic acid;4-methylmorpholine?
2-(methylamino)ethanesulfonic acid;4-methylmorpholine has a molecular weight of 240.32 g/mol, XLogP of -0.96, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)ethanesulfonic acid;4-methylmorpholine is sourced from PubChem (CID 157164072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).