C16H17NO — CID 15716418
1-[4-(4-methoxyphenyl)buta-1,3-diynyl]piperidine (PubChem CID 15716418) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)buta-1,3-diynyl]piperidine.
| Compound Name | 1-[4-(4-methoxyphenyl)buta-1,3-diynyl]piperidine |
|---|---|
| PubChem CID | 15716418 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)buta-1,3-diynyl]piperidine |
| SMILES | COc1ccc(C#CC#CN2CCCCC2)cc1 |
| InChI | InChI=1S/C16H17NO/c1-18-16-10-8-15(9-11-16)7-3-6-14-17-12-4-2-5-13-17/h8-11H,2,4-5,12-13H2,1H3 |
| InChIKey | LOUKSUREDXOGHK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|