C20H20Cl2F2N6O3 — CID 157164430
[4-(6-amino-5-methylidene-3-oxo-1,2,4-triazin-2-yl)-2,6-dichlorophenyl] (Z,4R)-3-carbamoyl-4-(3,3-difluorocyclobutyl)pent-2-enimidate (PubChem CID 157164430) has the molecular formula C20H20Cl2F2N6O3 and a molecular weight of 501.32 g/mol. Its IUPAC name is [4-(6-amino-5-methylidene-3-oxo-1,2,4-triazin-2-yl)-2,6-dichlorophenyl] (Z,4R)-3-carbamoyl-4-(3,3-difluorocyclobutyl)pent-2-enimidate.
| Compound Name | [4-(6-amino-5-methylidene-3-oxo-1,2,4-triazin-2-yl)-2,6-dichlorophenyl] (Z,4R)-3-carbamoyl-4-(3,3-difluorocyclobutyl)pent-2-enimidate |
|---|---|
| PubChem CID | 157164430 |
| Molecular Formula | C20H20Cl2F2N6O3 |
| Molecular Weight | 501.32 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | [4-(6-amino-5-methylidene-3-oxo-1,2,4-triazin-2-yl)-2,6-dichlorophenyl] (Z,4R)-3-carbamoyl-4-(3,3-difluorocyclobutyl)pent-2-enimidate |
| SMILES | [H]/N=C(\C=C(/C(N)=O)[C@H](C)C1CC(F)(F)C1)Oc1c(Cl)cc(N2N=C(N)C(=C)NC2=O)cc1Cl |
| InChI | InChI=1S/C20H20Cl2F2N6O3/c1-8(10-6-20(23,24)7-10)12(18(27)31)5-15(25)33-16-13(21)3-11(4-14(16)22)30-19(32)28-9(2)17(26)29-30/h3-5,8,10,25H,2,6-7H2,1H3,(H2,26,29)(H2,27,31)(H,28,32)/b12-5-,25-15+/t8-/m1/s1 |
| InChIKey | ZEFXGXOPSZDMDX-DXZPTZITSA-N |
| XLogP | 3.76 |
| TPSA | 146.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|