C33H70N8O6 — CID 157164761
2-N,2-N,4-N,4-N,6-N,6-N-hexakis[(2-methylpropan-2-yl)oxymethyl]-1,3,5-triazine-2,4,6-triamine;hydrazine (PubChem CID 157164761) has the molecular formula C33H70N8O6 and a molecular weight of 674.97 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N,6-N,6-N-hexakis[(2-methylpropan-2-yl)oxymethyl]-1,3,5-triazine-2,4,6-triamine;hydrazine.
| Compound Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexakis[(2-methylpropan-2-yl)oxymethyl]-1,3,5-triazine-2,4,6-triamine;hydrazine |
|---|---|
| PubChem CID | 157164761 |
| Molecular Formula | C33H70N8O6 |
| Molecular Weight | 674.97 g/mol |
| Exact Mass | 674.54 |
| IUPAC Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexakis[(2-methylpropan-2-yl)oxymethyl]-1,3,5-triazine-2,4,6-triamine;hydrazine |
| SMILES | CC(C)(C)OCN(COC(C)(C)C)c1nc(N(COC(C)(C)C)COC(C)(C)C)nc(N(COC(C)(C)C)COC(C)(C)C)n1.NN |
| InChI | InChI=1S/C33H66N6O6.H4N2/c1-28(2,3)40-19-37(20-41-29(4,5)6)25-34-26(38(21-42-30(7,8)9)22-43-31(10,11)12)36-27(35-25)39(23-44-32(13,14)15)24-45-33(16,17)18;1-2/h19-24H2,1-18H3;1-2H2 |
| InChIKey | AMTXBVGVCVPAGI-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 155.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.97 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|